C39H42O9 — CID 14925170
methyl 5-[3,5-bis(4-hydroxy-3-methoxycarbonyl-5-propylphenyl)phenyl]-2-hydroxy-3-propylbenzoate (PubChem CID 14925170) has the molecular formula C39H42O9 and a molecular weight of 654.76 g/mol. Its IUPAC name is methyl 5-[3,5-bis(4-hydroxy-3-methoxycarbonyl-5-propylphenyl)phenyl]-2-hydroxy-3-propylbenzoate.
| Compound Name | methyl 5-[3,5-bis(4-hydroxy-3-methoxycarbonyl-5-propylphenyl)phenyl]-2-hydroxy-3-propylbenzoate |
|---|---|
| PubChem CID | 14925170 |
| Molecular Formula | C39H42O9 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | methyl 5-[3,5-bis(4-hydroxy-3-methoxycarbonyl-5-propylphenyl)phenyl]-2-hydroxy-3-propylbenzoate |
| SMILES | CCCc1cc(-c2cc(-c3cc(CCC)c(O)c(C(=O)OC)c3)cc(-c3cc(CCC)c(O)c(C(=O)OC)c3)c2)cc(C(=O)OC)c1O |
| InChI | InChI=1S/C39H42O9/c1-7-10-22-13-28(19-31(34(22)40)37(43)46-4)25-16-26(29-14-23(11-8-2)35(41)32(20-29)38(44)47-5)18-27(17-25)30-15-24(12-9-3)36(42)33(21-30)39(45)48-6/h13-21,40-42H,7-12H2,1-6H3 |
| InChIKey | OOGYAJJLDZXONI-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|