C12H8BrNO3 — CID 149252139
[5-bromo-3-(1,3-oxazol-4-yl)-1-benzofuran-2-yl]methanol (PubChem CID 149252139) has the molecular formula C12H8BrNO3 and a molecular weight of 294.10 g/mol. Its IUPAC name is [5-bromo-3-(1,3-oxazol-4-yl)-1-benzofuran-2-yl]methanol.
| Compound Name | [5-bromo-3-(1,3-oxazol-4-yl)-1-benzofuran-2-yl]methanol |
|---|---|
| PubChem CID | 149252139 |
| Molecular Formula | C12H8BrNO3 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | [5-bromo-3-(1,3-oxazol-4-yl)-1-benzofuran-2-yl]methanol |
| SMILES | OCc1oc2ccc(Br)cc2c1-c1cocn1 |
| InChI | InChI=1S/C12H8BrNO3/c13-7-1-2-10-8(3-7)12(11(4-15)17-10)9-5-16-6-14-9/h1-3,5-6,15H,4H2 |
| InChIKey | DDAJQNUWLMUBMI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |