C22H39N7O3 — CID 149253274
1-methyl-3-morpholin-4-yl-3,4-di(piperazin-1-yl)-4-piperidin-1-ylpyrrolidine-2,5-dione (PubChem CID 149253274) has the molecular formula C22H39N7O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-methyl-3-morpholin-4-yl-3,4-di(piperazin-1-yl)-4-piperidin-1-ylpyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-morpholin-4-yl-3,4-di(piperazin-1-yl)-4-piperidin-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 149253274 |
| Molecular Formula | C22H39N7O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | 1-methyl-3-morpholin-4-yl-3,4-di(piperazin-1-yl)-4-piperidin-1-ylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C(N2CCCCC2)(N2CCNCC2)C(N2CCNCC2)(N2CCOCC2)C1=O |
| InChI | InChI=1S/C22H39N7O3/c1-25-19(30)21(26-9-3-2-4-10-26,27-11-5-23-6-12-27)22(20(25)31,28-13-7-24-8-14-28)29-15-17-32-18-16-29/h23-24H,2-18H2,1H3 |
| InChIKey | PWKNIOADRCMQNE-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|