C16H26N4O4 — CID 98890419
(5S)-5-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 98890419) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is (5S)-5-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 98890419 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (5S)-5-[2-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CN(C2CCN(C(=O)C[C@@H]3NC(=O)NC3=O)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H26N4O4/c1-10-8-20(9-11(2)24-10)12-3-5-19(6-4-12)14(21)7-13-15(22)18-16(23)17-13/h10-13H,3-9H2,1-2H3,(H2,17,18,22,23)/t10-,11+,13-/m0/s1 |
| InChIKey | AMCNNKJKFDOZPN-LOWVWBTDSA-N |
| XLogP | -0.32 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|