C16H26N4O6 — CID 88940721
2-(2,5-dioxopyrrolidin-1-yl)-N-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethyl]propanamide (PubChem CID 88940721) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethyl]propanamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 88940721 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethyl]propanamide |
| SMILES | COC(C)C(=O)NCCC(=O)NC(C)NC(=O)C(C)N1C(=O)CCC1=O |
| InChI | InChI=1S/C16H26N4O6/c1-9(20-13(22)5-6-14(20)23)15(24)19-11(3)18-12(21)7-8-17-16(25)10(2)26-4/h9-11H,5-8H2,1-4H3,(H,17,25)(H,18,21)(H,19,24) |
| InChIKey | UXYXBLFVFFJFEY-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|