C17H28N4O3 — CID 152695543
3-morpholin-4-yl-3-piperidin-1-yl-4-pyrrolidin-1-ylpyrrolidine-2,5-dione (PubChem CID 152695543) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-morpholin-4-yl-3-piperidin-1-yl-4-pyrrolidin-1-ylpyrrolidine-2,5-dione.
| Compound Name | 3-morpholin-4-yl-3-piperidin-1-yl-4-pyrrolidin-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 152695543 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 3-morpholin-4-yl-3-piperidin-1-yl-4-pyrrolidin-1-ylpyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(N2CCCCC2)(N2CCOCC2)C1N1CCCC1 |
| InChI | InChI=1S/C17H28N4O3/c22-15-14(19-6-4-5-7-19)17(16(23)18-15,20-8-2-1-3-9-20)21-10-12-24-13-11-21/h14H,1-13H2,(H,18,22,23) |
| InChIKey | ZQLPMZWYAQRIDN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|