C18H24N2OS — CID 14925503
(3R)-N-hexyl-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-c]pyridine-3-carboxamide (PubChem CID 14925503) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is (3R)-N-hexyl-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-c]pyridine-3-carboxamide.
| Compound Name | (3R)-N-hexyl-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 14925503 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (3R)-N-hexyl-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-c]pyridine-3-carboxamide |
| SMILES | CCCCCCNC(=O)[C@H]1Cc2c(sc3ccccc23)CN1 |
| InChI | InChI=1S/C18H24N2OS/c1-2-3-4-7-10-19-18(21)15-11-14-13-8-5-6-9-16(13)22-17(14)12-20-15/h5-6,8-9,15,20H,2-4,7,10-12H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | FACWIKHBNKTPKJ-OAHLLOKOSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|