C23H30N6OS — CID 149256090
3-amino-N-[2-(4-piperazin-1-ylphenyl)ethyl]-6-(propan-2-ylamino)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 149256090) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is 3-amino-N-[2-(4-piperazin-1-ylphenyl)ethyl]-6-(propan-2-ylamino)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[2-(4-piperazin-1-ylphenyl)ethyl]-6-(propan-2-ylamino)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 149256090 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 3-amino-N-[2-(4-piperazin-1-ylphenyl)ethyl]-6-(propan-2-ylamino)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CC(C)Nc1ccc2c(N)c(C(=O)NCCc3ccc(N4CCNCC4)cc3)sc2n1 |
| InChI | InChI=1S/C23H30N6OS/c1-15(2)27-19-8-7-18-20(24)21(31-23(18)28-19)22(30)26-10-9-16-3-5-17(6-4-16)29-13-11-25-12-14-29/h3-8,15,25H,9-14,24H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | XOHUFAXSTJMQRB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|