C20H23ClN2O — CID 149256926
6-chloro-N-(1,1-dideuterio-2,2-dimethylpropyl)-4-methyl-4-phenyl-1H-3,1-benzoxazin-2-imine (PubChem CID 149256926) has the molecular formula C20H23ClN2O and a molecular weight of 344.88 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dideuterio-2,2-dimethylpropyl)-4-methyl-4-phenyl-1H-3,1-benzoxazin-2-imine.
| Compound Name | 6-chloro-N-(1,1-dideuterio-2,2-dimethylpropyl)-4-methyl-4-phenyl-1H-3,1-benzoxazin-2-imine |
|---|---|
| PubChem CID | 149256926 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 6-chloro-N-(1,1-dideuterio-2,2-dimethylpropyl)-4-methyl-4-phenyl-1H-3,1-benzoxazin-2-imine |
| SMILES | [2H]C([2H])(/N=C1\Nc2ccc(Cl)cc2C(C)(c2ccccc2)O1)C(C)(C)C |
| InChI | InChI=1S/C20H23ClN2O/c1-19(2,3)13-22-18-23-17-11-10-15(21)12-16(17)20(4,24-18)14-8-6-5-7-9-14/h5-12H,13H2,1-4H3,(H,22,23)/i13D2 |
| InChIKey | XOLZUKUFECJZFL-KLTYLHELSA-N |
| XLogP | 5.45 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|