C18H20N2O — CID 164671389
(4R)-N-ethyl-4,8-dimethyl-4-phenyl-1H-3,1-benzoxazin-2-imine (PubChem CID 164671389) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (4R)-N-ethyl-4,8-dimethyl-4-phenyl-1H-3,1-benzoxazin-2-imine.
| Compound Name | (4R)-N-ethyl-4,8-dimethyl-4-phenyl-1H-3,1-benzoxazin-2-imine |
|---|---|
| PubChem CID | 164671389 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (4R)-N-ethyl-4,8-dimethyl-4-phenyl-1H-3,1-benzoxazin-2-imine |
| SMILES | CC/N=C1\Nc2c(C)cccc2[C@@](C)(c2ccccc2)O1 |
| InChI | InChI=1S/C18H20N2O/c1-4-19-17-20-16-13(2)9-8-12-15(16)18(3,21-17)14-10-6-5-7-11-14/h5-12H,4H2,1-3H3,(H,19,20)/t18-/m1/s1 |
| InChIKey | OYCRKOXHLHOCEU-GOSISDBHSA-N |
| XLogP | 4.08 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|