C23H28N2 — CID 139353420
(2Z)-N-methyl-2-(3,3,4,4,8-pentamethyl-1H-quinolin-2-ylidene)-2-phenylethanimine (PubChem CID 139353420) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (2Z)-N-methyl-2-(3,3,4,4,8-pentamethyl-1H-quinolin-2-ylidene)-2-phenylethanimine.
| Compound Name | (2Z)-N-methyl-2-(3,3,4,4,8-pentamethyl-1H-quinolin-2-ylidene)-2-phenylethanimine |
|---|---|
| PubChem CID | 139353420 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (2Z)-N-methyl-2-(3,3,4,4,8-pentamethyl-1H-quinolin-2-ylidene)-2-phenylethanimine |
| SMILES | C/N=C/C(=C1\Nc2c(C)cccc2C(C)(C)C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H28N2/c1-16-11-10-14-19-20(16)25-21(23(4,5)22(19,2)3)18(15-24-6)17-12-8-7-9-13-17/h7-15,25H,1-6H3/b21-18+,24-15+ |
| InChIKey | HFBJLOGWRSXUBW-FFWBGTRHSA-N |
| XLogP | 5.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|