C28H43N5O2 — CID 149261136
1-[[(9R,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-ethyl-1-[3-[methyl(2-oxopropyl)amino]propyl]urea (PubChem CID 149261136) has the molecular formula C28H43N5O2 and a molecular weight of 481.69 g/mol. Its IUPAC name is 1-[[(9R,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-ethyl-1-[3-[methyl(2-oxopropyl)amino]propyl]urea.
| Compound Name | 1-[[(9R,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-ethyl-1-[3-[methyl(2-oxopropyl)amino]propyl]urea |
|---|---|
| PubChem CID | 149261136 |
| Molecular Formula | C28H43N5O2 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | 1-[[(9R,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-ethyl-1-[3-[methyl(2-oxopropyl)amino]propyl]urea |
| SMILES | CCCN1C[C@H](CN(CCCN(C)CC(C)=O)C(=O)NCC)C[C@@H]2c3cccc4[nH]cc(c34)CC21 |
| InChI | InChI=1S/C28H43N5O2/c1-5-11-32-18-21(19-33(28(35)29-6-2)13-8-12-31(4)17-20(3)34)14-24-23-9-7-10-25-27(23)22(16-30-25)15-26(24)32/h7,9-10,16,21,24,26,30H,5-6,8,11-15,17-19H2,1-4H3,(H,29,35)/t21-,24-,26?/m1/s1 |
| InChIKey | XPGGLRMKLMXEEJ-KRNSLYCCSA-N |
| XLogP | 3.85 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |