C19H21NO4S — CID 1492612
methyl 2-[4-(4-methoxyphenyl)-3-oxo-5-piperidin-1-ylthiophen-2-ylidene]acetate (PubChem CID 1492612) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is methyl 2-[4-(4-methoxyphenyl)-3-oxo-5-piperidin-1-ylthiophen-2-ylidene]acetate.
| Compound Name | methyl 2-[4-(4-methoxyphenyl)-3-oxo-5-piperidin-1-ylthiophen-2-ylidene]acetate |
|---|---|
| PubChem CID | 1492612 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 2-[4-(4-methoxyphenyl)-3-oxo-5-piperidin-1-ylthiophen-2-ylidene]acetate |
| SMILES | COC(=O)C=C1SC(N2CCCCC2)=C(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C19H21NO4S/c1-23-14-8-6-13(7-9-14)17-18(22)15(12-16(21)24-2)25-19(17)20-10-4-3-5-11-20/h6-9,12H,3-5,10-11H2,1-2H3 |
| InChIKey | LNEIKHIMGFIEOB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_M(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|