C23H29N5O2 — CID 149271835
2-[3-[[3-(dimethylamino)propyl-methylamino]-hydroxymethyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 149271835) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[3-[[3-(dimethylamino)propyl-methylamino]-hydroxymethyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[3-[[3-(dimethylamino)propyl-methylamino]-hydroxymethyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 149271835 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[3-[[3-(dimethylamino)propyl-methylamino]-hydroxymethyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | CN(C)CCCN(C)C(O)c1cccc(-c2nc3cccc4c3n2CCNC4=O)c1 |
| InChI | InChI=1S/C23H29N5O2/c1-26(2)12-6-13-27(3)23(30)17-8-4-7-16(15-17)21-25-19-10-5-9-18-20(19)28(21)14-11-24-22(18)29/h4-5,7-10,15,23,30H,6,11-14H2,1-3H3,(H,24,29) |
| InChIKey | XRFOXDRYFASTOR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|