C17H24ClN5 — CID 149290998
3-[4-[3-(4-chlorophenyl)butyl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine (PubChem CID 149290998) has the molecular formula C17H24ClN5 and a molecular weight of 333.87 g/mol. Its IUPAC name is 3-[4-[3-(4-chlorophenyl)butyl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[4-[3-(4-chlorophenyl)butyl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 149290998 |
| Molecular Formula | C17H24ClN5 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[4-[3-(4-chlorophenyl)butyl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine |
| SMILES | CC(CCC1CCN(c2n[nH]c(N)n2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClN5/c1-12(14-4-6-15(18)7-5-14)2-3-13-8-10-23(11-9-13)17-20-16(19)21-22-17/h4-7,12-13H,2-3,8-11H2,1H3,(H3,19,20,21,22) |
| InChIKey | XUVJQZJULHQTSU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |