C10H19N5 — CID 66277764
3-(4-ethylazepan-1-yl)-1H-1,2,4-triazol-5-amine (PubChem CID 66277764) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 3-(4-ethylazepan-1-yl)-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(4-ethylazepan-1-yl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 66277764 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 3-(4-ethylazepan-1-yl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCC1CCCN(c2n[nH]c(N)n2)CC1 |
| InChI | InChI=1S/C10H19N5/c1-2-8-4-3-6-15(7-5-8)10-12-9(11)13-14-10/h8H,2-7H2,1H3,(H3,11,12,13,14) |
| InChIKey | MRUXZJYRNKGDAD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |