About 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole
4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole (PubChem CID 149294825) has the molecular formula C12H11BrIN3
and a molecular weight of 404.05 g/mol. Its IUPAC name is 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole.
Molecular Properties
| Compound Name | 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole |
| PubChem CID | 149294825 |
| Molecular Formula | C12H11BrIN3 |
| Molecular Weight | 404.05 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole |
| SMILES | Brc1nnn(CCc2ccccc2)c1C1=IC1 |
| InChI | InChI=1S/C12H11BrIN3/c13-12-11(10-8-14-10)17(16-15-12)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | XVONTNVRAIUPGA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.05 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole?
The IUPAC name of 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole (CID 149294825) is 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole.
What is the SMILES notation for 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole?
The canonical SMILES for 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole is Brc1nnn(CCc2ccccc2)c1C1=IC1.
What is the InChIKey of 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole?
The InChIKey is XVONTNVRAIUPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrIN3/c13-12-11(10-8-14-10)17(16-15-12)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2.
What are the key properties of 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole?
4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole has a molecular weight of 404.05 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-(1λ3-iodacyclopropen-2-yl)-1-(2-phenylethyl)triazole is sourced from PubChem (CID 149294825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).