C8H8ClN3 — CID 14929597
2-chloro-3,6-dimethylimidazo[4,5-b]pyridine (PubChem CID 14929597) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 2-chloro-3,6-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 2-chloro-3,6-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 14929597 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-chloro-3,6-dimethylimidazo[4,5-b]pyridine |
| SMILES | Cc1cnc2c(c1)nc(Cl)n2C |
| InChI | InChI=1S/C8H8ClN3/c1-5-3-6-7(10-4-5)12(2)8(9)11-6/h3-4H,1-2H3 |
| InChIKey | FCBSRNBRLFSILK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |