C16H11NO3 — CID 149307550
4-phenacylfuro[3,2-c]pyridine-2-carbaldehyde (PubChem CID 149307550) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-phenacylfuro[3,2-c]pyridine-2-carbaldehyde.
| Compound Name | 4-phenacylfuro[3,2-c]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 149307550 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-phenacylfuro[3,2-c]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2c(CC(=O)c3ccccc3)nccc2o1 |
| InChI | InChI=1S/C16H11NO3/c18-10-12-8-13-14(17-7-6-16(13)20-12)9-15(19)11-4-2-1-3-5-11/h1-8,10H,9H2 |
| InChIKey | XXYXMAYKVSLZRF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|