C27H22O5 — CID 57381075
1,3-bis(5-phenacylfuran-2-yl)propan-2-one (PubChem CID 57381075) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 1,3-bis(5-phenacylfuran-2-yl)propan-2-one.
| Compound Name | 1,3-bis(5-phenacylfuran-2-yl)propan-2-one |
|---|---|
| PubChem CID | 57381075 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1,3-bis(5-phenacylfuran-2-yl)propan-2-one |
| SMILES | O=C(Cc1ccc(CC(=O)c2ccccc2)o1)Cc1ccc(CC(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C27H22O5/c28-21(15-22-11-13-24(31-22)17-26(29)19-7-3-1-4-8-19)16-23-12-14-25(32-23)18-27(30)20-9-5-2-6-10-20/h1-14H,15-18H2 |
| InChIKey | PFJCGBIEVRQLLT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |