About 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole
7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole (PubChem CID 149307724) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole.
Analyze 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole?
The IUPAC name of 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole (CID 149307724) is 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole.
What is the SMILES notation for 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole?
The canonical SMILES for 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole is CC1Cc2[nH]ncc2CCO1.
What is the InChIKey of 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole?
The InChIKey is XXZSZPZDILELIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-4-8-7(2-3-11-6)5-9-10-8/h5-6H,2-4H2,1H3,(H,9,10).
What are the key properties of 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole?
7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole has a molecular weight of 152.20 g/mol, XLogP of 0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4,5,7,8-tetrahydro-1H-oxepino[4,5-d]pyrazole is sourced from PubChem (CID 149307724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).