C13H22N2O2 — CID 54445802
5-ethyl-4-(2-propan-2-yl-1,3-dioxepan-5-yl)-1H-pyrazole (PubChem CID 54445802) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 5-ethyl-4-(2-propan-2-yl-1,3-dioxepan-5-yl)-1H-pyrazole.
| Compound Name | 5-ethyl-4-(2-propan-2-yl-1,3-dioxepan-5-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 54445802 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 5-ethyl-4-(2-propan-2-yl-1,3-dioxepan-5-yl)-1H-pyrazole |
| SMILES | CCc1[nH]ncc1C1CCOC(C(C)C)OC1 |
| InChI | InChI=1S/C13H22N2O2/c1-4-12-11(7-14-15-12)10-5-6-16-13(9(2)3)17-8-10/h7,9-10,13H,4-6,8H2,1-3H3,(H,14,15) |
| InChIKey | GTVCYCZIEYFMPW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |