C25H31N3O2 — CID 149308826
ethyl 4-(2-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate (PubChem CID 149308826) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethyl 4-(2-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate.
| Compound Name | ethyl 4-(2-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 149308826 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethyl 4-(2-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(CC2C3CC4CC(C3)CC2C4)c(NCc2ccncn2)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-2-30-25(29)19-4-3-18(24(13-19)27-14-22-5-6-26-15-28-22)12-23-20-8-16-7-17(10-20)11-21(23)9-16/h3-6,13,15-17,20-21,23,27H,2,7-12,14H2,1H3 |
| InChIKey | XYFBIWUMKFHQCD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |