C17H28O3SSi — CID 14930974
S-ethyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylpropanethioate (PubChem CID 14930974) has the molecular formula C17H28O3SSi and a molecular weight of 340.56 g/mol. Its IUPAC name is S-ethyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylpropanethioate.
| Compound Name | S-ethyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylpropanethioate |
|---|---|
| PubChem CID | 14930974 |
| Molecular Formula | C17H28O3SSi |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | S-ethyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylpropanethioate |
| SMILES | CCSC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H28O3SSi/c1-7-21-16(19)15(20-22(5,6)17(2,3)4)14(18)13-11-9-8-10-12-13/h8-12,14-15,18H,7H2,1-6H3/t14-,15+/m1/s1 |
| InChIKey | UWFPTJRCIOEFBL-CABCVRRESA-N |
| XLogP | 4.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|