C22H18N4OS — CID 149311701
1-(5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-one (PubChem CID 149311701) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-(5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-one.
| Compound Name | 1-(5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-one |
|---|---|
| PubChem CID | 149311701 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-(5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-one |
| SMILES | O=C1CCCN(c2nc(-c3ccccn3)nc3scc(-c4ccccc4)c23)C1 |
| InChI | InChI=1S/C22H18N4OS/c27-16-9-6-12-26(13-16)21-19-17(15-7-2-1-3-8-15)14-28-22(19)25-20(24-21)18-10-4-5-11-23-18/h1-5,7-8,10-11,14H,6,9,12-13H2 |
| InChIKey | XYSQECBPVGJDJJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |