C16H21N3O2 — CID 149312118
N-(4-aminocyclohexyl)-3-oxo-2,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 149312118) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-oxo-2,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-3-oxo-2,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 149312118 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-oxo-2,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | NC1CCC(NC(=O)c2ccc3c(c2)CC(=O)CN3)CC1 |
| InChI | InChI=1S/C16H21N3O2/c17-12-2-4-13(5-3-12)19-16(21)10-1-6-15-11(7-10)8-14(20)9-18-15/h1,6-7,12-13,18H,2-5,8-9,17H2,(H,19,21) |
| InChIKey | XYURXVGIKSHFJP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |