C11H19F6NS — CID 149317784
(2S)-1,1,1-trifluoro-N-[(2S)-4-(3,3,3-trifluoropropylsulfanyl)butan-2-yl]butan-2-amine (PubChem CID 149317784) has the molecular formula C11H19F6NS and a molecular weight of 311.34 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-N-[(2S)-4-(3,3,3-trifluoropropylsulfanyl)butan-2-yl]butan-2-amine.
| Compound Name | (2S)-1,1,1-trifluoro-N-[(2S)-4-(3,3,3-trifluoropropylsulfanyl)butan-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 149317784 |
| Molecular Formula | C11H19F6NS |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2S)-1,1,1-trifluoro-N-[(2S)-4-(3,3,3-trifluoropropylsulfanyl)butan-2-yl]butan-2-amine |
| SMILES | CC[C@H](N[C@@H](C)CCSCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H19F6NS/c1-3-9(11(15,16)17)18-8(2)4-6-19-7-5-10(12,13)14/h8-9,18H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | XZVWIWJODYJABG-IUCAKERBSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|