About S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate
S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate (PubChem CID 14932282) has the molecular formula C10H19BrO2S
and a molecular weight of 283.23 g/mol. Its IUPAC name is S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate.
Molecular Properties
| Compound Name | S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate |
| PubChem CID | 14932282 |
| Molecular Formula | C10H19BrO2S |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate |
| SMILES | CC(C)[C@H](O)[C@H](Br)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C10H19BrO2S/c1-6(2)8(12)7(11)9(13)14-10(3,4)5/h6-8,12H,1-5H3/t7-,8-/m0/s1 |
| InChIKey | SZVHPQBGWZSHGF-YUMQZZPRSA-N |
| XLogP | 2.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate?
The IUPAC name of S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate (CID 14932282) is S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate.
What is the SMILES notation for S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate?
The canonical SMILES for S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate is CC(C)[C@H](O)[C@H](Br)C(=O)SC(C)(C)C.
What is the InChIKey of S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate?
The InChIKey is SZVHPQBGWZSHGF-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H19BrO2S/c1-6(2)8(12)7(11)9(13)14-10(3,4)5/h6-8,12H,1-5H3/t7-,8-/m0/s1.
What are the key properties of S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate?
S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate has a molecular weight of 283.23 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanethioate is sourced from PubChem (CID 14932282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).