C22H19NO2 — CID 149323151
4-(2,6-dimethylphenyl)-5-(2-methyl-1H-indol-3-yl)cyclopent-4-ene-1,3-dione (PubChem CID 149323151) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-5-(2-methyl-1H-indol-3-yl)cyclopent-4-ene-1,3-dione.
| Compound Name | 4-(2,6-dimethylphenyl)-5-(2-methyl-1H-indol-3-yl)cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 149323151 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-5-(2-methyl-1H-indol-3-yl)cyclopent-4-ene-1,3-dione |
| SMILES | Cc1cccc(C)c1C1=C(c2c(C)[nH]c3ccccc23)C(=O)CC1=O |
| InChI | InChI=1S/C22H19NO2/c1-12-7-6-8-13(2)19(12)21-17(24)11-18(25)22(21)20-14(3)23-16-10-5-4-9-15(16)20/h4-10,23H,11H2,1-3H3 |
| InChIKey | YAVZHDXQLMEMGF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|