C13H9BrN2O2 — CID 11522357
3-bromo-4-(2-methyl-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 11522357) has the molecular formula C13H9BrN2O2 and a molecular weight of 305.13 g/mol. Its IUPAC name is 3-bromo-4-(2-methyl-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-bromo-4-(2-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11522357 |
| Molecular Formula | C13H9BrN2O2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 3-bromo-4-(2-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1[nH]c2ccccc2c1C1=C(Br)C(=O)NC1=O |
| InChI | InChI=1S/C13H9BrN2O2/c1-6-9(7-4-2-3-5-8(7)15-6)10-11(14)13(18)16-12(10)17/h2-5,15H,1H3,(H,16,17,18) |
| InChIKey | WCWIIIUZHZNLRZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|