C25H24BrN3O3 — CID 11576849
6-[3-(4-bromo-2,5-dioxopyrrol-3-yl)-1H-indol-2-yl]-N-(2-methylphenyl)hexanamide (PubChem CID 11576849) has the molecular formula C25H24BrN3O3 and a molecular weight of 494.39 g/mol. Its IUPAC name is 6-[3-(4-bromo-2,5-dioxopyrrol-3-yl)-1H-indol-2-yl]-N-(2-methylphenyl)hexanamide.
| Compound Name | 6-[3-(4-bromo-2,5-dioxopyrrol-3-yl)-1H-indol-2-yl]-N-(2-methylphenyl)hexanamide |
|---|---|
| PubChem CID | 11576849 |
| Molecular Formula | C25H24BrN3O3 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 6-[3-(4-bromo-2,5-dioxopyrrol-3-yl)-1H-indol-2-yl]-N-(2-methylphenyl)hexanamide |
| SMILES | Cc1ccccc1NC(=O)CCCCCc1[nH]c2ccccc2c1C1=C(Br)C(=O)NC1=O |
| InChI | InChI=1S/C25H24BrN3O3/c1-15-9-5-7-11-17(15)28-20(30)14-4-2-3-13-19-21(16-10-6-8-12-18(16)27-19)22-23(26)25(32)29-24(22)31/h5-12,27H,2-4,13-14H2,1H3,(H,28,30)(H,29,31,32) |
| InChIKey | ZXZDOTMNUDPILE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|