C33H40N2O4 — CID 149335721
(2R,5S)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-5,8,8-trimethyl-4,7-dioxo-2-propan-2-ylnonanamide (PubChem CID 149335721) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is (2R,5S)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-5,8,8-trimethyl-4,7-dioxo-2-propan-2-ylnonanamide.
| Compound Name | (2R,5S)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-5,8,8-trimethyl-4,7-dioxo-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 149335721 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | (2R,5S)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-5,8,8-trimethyl-4,7-dioxo-2-propan-2-ylnonanamide |
| SMILES | CC(C)C(CC(=O)[C@@H](C)CC(=O)C(C)(C)C)C(=O)NCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C33H40N2O4/c1-22(2)27(20-29(36)23(3)19-30(37)33(4,5)6)32(39)34-18-17-31(38)35-21-26-13-8-7-11-24(26)15-16-25-12-9-10-14-28(25)35/h7-14,22-23,27H,17-21H2,1-6H3,(H,34,39)/t23-,27?/m0/s1 |
| InChIKey | YDERGWPNWFVZKZ-DCCUJTHKSA-N |
| XLogP | 5.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|