C31H25F3N6O — CID 14936510
2-ethoxy-4-phenyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile (PubChem CID 14936510) has the molecular formula C31H25F3N6O and a molecular weight of 554.58 g/mol. Its IUPAC name is 2-ethoxy-4-phenyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile.
| Compound Name | 2-ethoxy-4-phenyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 14936510 |
| Molecular Formula | C31H25F3N6O |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 2-ethoxy-4-phenyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile |
| SMILES | CCOc1nc2nc3ccnc(N4CCN(c5cccc(C(F)(F)F)c5)CC4)c3cc2c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C31H25F3N6O/c1-2-41-30-25(19-35)27(20-7-4-3-5-8-20)24-18-23-26(37-28(24)38-30)11-12-36-29(23)40-15-13-39(14-16-40)22-10-6-9-21(17-22)31(32,33)34/h3-12,17-18H,2,13-16H2,1H3 |
| InChIKey | BTXSYXIWWWSWLI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 78.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|