C19H18N4O4S — CID 1493672
5-(4-methoxybenzoyl)imino-2-(4-methoxyphenyl)-N-methylthiadiazole-4-carboxamide (PubChem CID 1493672) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 5-(4-methoxybenzoyl)imino-2-(4-methoxyphenyl)-N-methylthiadiazole-4-carboxamide.
| Compound Name | 5-(4-methoxybenzoyl)imino-2-(4-methoxyphenyl)-N-methylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1493672 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 5-(4-methoxybenzoyl)imino-2-(4-methoxyphenyl)-N-methylthiadiazole-4-carboxamide |
| SMILES | CNC(=O)c1nn(-c2ccc(OC)cc2)s/c1=N\C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H18N4O4S/c1-20-18(25)16-19(21-17(24)12-4-8-14(26-2)9-5-12)28-23(22-16)13-6-10-15(27-3)11-7-13/h4-11H,1-3H3,(H,20,25)/b21-19- |
| InChIKey | UKUMWDPMVUYKDQ-VZCXRCSSSA-N |
| XLogP | 2.05 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |