C23H17ClN4O3S — CID 1493673
5-(4-chlorobenzoyl)imino-2-(4-methoxyphenyl)-N-phenylthiadiazole-4-carboxamide (PubChem CID 1493673) has the molecular formula C23H17ClN4O3S and a molecular weight of 464.93 g/mol. Its IUPAC name is 5-(4-chlorobenzoyl)imino-2-(4-methoxyphenyl)-N-phenylthiadiazole-4-carboxamide.
| Compound Name | 5-(4-chlorobenzoyl)imino-2-(4-methoxyphenyl)-N-phenylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1493673 |
| Molecular Formula | C23H17ClN4O3S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 5-(4-chlorobenzoyl)imino-2-(4-methoxyphenyl)-N-phenylthiadiazole-4-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)Nc3ccccc3)/c(=N/C(=O)c3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C23H17ClN4O3S/c1-31-19-13-11-18(12-14-19)28-27-20(22(30)25-17-5-3-2-4-6-17)23(32-28)26-21(29)15-7-9-16(24)10-8-15/h2-14H,1H3,(H,25,30)/b26-23- |
| InChIKey | WUSAFIWUSRQGKA-RWEWTDSWSA-N |
| XLogP | 4.59 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |