C20H40OSi — CID 14936989
tri(propan-2-yl)-undeca-1,2-dien-4-yloxysilane (PubChem CID 14936989) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is tri(propan-2-yl)-undeca-1,2-dien-4-yloxysilane.
| Compound Name | tri(propan-2-yl)-undeca-1,2-dien-4-yloxysilane |
|---|---|
| PubChem CID | 14936989 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tri(propan-2-yl)-undeca-1,2-dien-4-yloxysilane |
| SMILES | C=C=CC(CCCCCCC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40OSi/c1-9-11-12-13-14-16-20(15-10-2)21-22(17(3)4,18(5)6)19(7)8/h15,17-20H,2,9,11-14,16H2,1,3-8H3 |
| InChIKey | OTQVAKAIGKGOGP-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|