C21H19Cl2N5O3 — CID 149373300
1-[2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]-5-methoxyphenyl]but-3-en-2-one (PubChem CID 149373300) has the molecular formula C21H19Cl2N5O3 and a molecular weight of 460.32 g/mol. Its IUPAC name is 1-[2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]-5-methoxyphenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]-5-methoxyphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 149373300 |
| Molecular Formula | C21H19Cl2N5O3 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 1-[2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]-5-methoxyphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(OC)ccc1Nc1nc(Nc2cc(Cl)nc(OC)c2)ncc1Cl |
| InChI | InChI=1S/C21H19Cl2N5O3/c1-4-14(29)7-12-8-15(30-2)5-6-17(12)26-20-16(22)11-24-21(28-20)25-13-9-18(23)27-19(10-13)31-3/h4-6,8-11H,1,7H2,2-3H3,(H2,24,25,26,27,28) |
| InChIKey | YKFWQEFLNIZNBI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|