C23H24ClN5O2 — CID 134798914
2-(3-chlorophenyl)-1-[4-[4-(4-methoxyanilino)pyrimidin-2-yl]piperazin-1-yl]ethanone (PubChem CID 134798914) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[4-[4-(4-methoxyanilino)pyrimidin-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-[4-[4-(4-methoxyanilino)pyrimidin-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134798914 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[4-[4-(4-methoxyanilino)pyrimidin-2-yl]piperazin-1-yl]ethanone |
| SMILES | COc1ccc(Nc2ccnc(N3CCN(C(=O)Cc4cccc(Cl)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H24ClN5O2/c1-31-20-7-5-19(6-8-20)26-21-9-10-25-23(27-21)29-13-11-28(12-14-29)22(30)16-17-3-2-4-18(24)15-17/h2-10,15H,11-14,16H2,1H3,(H,25,26,27) |
| InChIKey | BKFYUZZWTQOLMC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |