C14H18BrNO — CID 149374559
3-(6-bromo-2-methylindol-1-yl)-2,2-dimethylpropan-1-ol (PubChem CID 149374559) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is 3-(6-bromo-2-methylindol-1-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(6-bromo-2-methylindol-1-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 149374559 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-(6-bromo-2-methylindol-1-yl)-2,2-dimethylpropan-1-ol |
| SMILES | Cc1cc2ccc(Br)cc2n1CC(C)(C)CO |
| InChI | InChI=1S/C14H18BrNO/c1-10-6-11-4-5-12(15)7-13(11)16(10)8-14(2,3)9-17/h4-7,17H,8-9H2,1-3H3 |
| InChIKey | YKMCBMDACFLIMY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |