C19H16S — CID 149377326
4-methyl-6-phenyl-2,3-dihydrodibenzothiophene (PubChem CID 149377326) has the molecular formula C19H16S and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-methyl-6-phenyl-2,3-dihydrodibenzothiophene.
| Compound Name | 4-methyl-6-phenyl-2,3-dihydrodibenzothiophene |
|---|---|
| PubChem CID | 149377326 |
| Molecular Formula | C19H16S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-methyl-6-phenyl-2,3-dihydrodibenzothiophene |
| SMILES | CC1=c2sc3c(-c4ccccc4)cccc3c2=CCC1 |
| InChI | InChI=1S/C19H16S/c1-13-7-5-11-16-17-12-6-10-15(19(17)20-18(13)16)14-8-3-2-4-9-14/h2-4,6,8-12H,5,7H2,1H3 |
| InChIKey | YKZCMWAVVRZCCA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |