C19H13F4NO2S — CID 149380733
(3S)-3-(3-fluoro-2-pyridinyl)-1-thiophen-2-yl-3-[4-(trifluoromethoxy)phenyl]propan-1-one (PubChem CID 149380733) has the molecular formula C19H13F4NO2S and a molecular weight of 395.38 g/mol. Its IUPAC name is (3S)-3-(3-fluoro-2-pyridinyl)-1-thiophen-2-yl-3-[4-(trifluoromethoxy)phenyl]propan-1-one.
| Compound Name | (3S)-3-(3-fluoro-2-pyridinyl)-1-thiophen-2-yl-3-[4-(trifluoromethoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 149380733 |
| Molecular Formula | C19H13F4NO2S |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | (3S)-3-(3-fluoro-2-pyridinyl)-1-thiophen-2-yl-3-[4-(trifluoromethoxy)phenyl]propan-1-one |
| SMILES | O=C(C[C@@H](c1ccc(OC(F)(F)F)cc1)c1ncccc1F)c1cccs1 |
| InChI | InChI=1S/C19H13F4NO2S/c20-15-3-1-9-24-18(15)14(11-16(25)17-4-2-10-27-17)12-5-7-13(8-6-12)26-19(21,22)23/h1-10,14H,11H2/t14-/m0/s1 |
| InChIKey | YLPFQZYINKPDDS-AWEZNQCLSA-N |
| XLogP | 5.59 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |