C23H15F4NO3 — CID 162088166
6-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]-3H-1-benzofuran-2-one (PubChem CID 162088166) has the molecular formula C23H15F4NO3 and a molecular weight of 429.37 g/mol. Its IUPAC name is 6-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]-3H-1-benzofuran-2-one.
| Compound Name | 6-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 162088166 |
| Molecular Formula | C23H15F4NO3 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 6-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]-3H-1-benzofuran-2-one |
| SMILES | O=C1Cc2ccc(C(=O)C[C@@H](c3ccc(C(F)(F)F)cc3)c3ncccc3F)cc2O1 |
| InChI | InChI=1S/C23H15F4NO3/c24-18-2-1-9-28-22(18)17(13-5-7-16(8-6-13)23(25,26)27)12-19(29)14-3-4-15-11-21(30)31-20(15)10-14/h1-10,17H,11-12H2/t17-/m0/s1 |
| InChIKey | ZDGAABREBRIFQR-KRWDZBQOSA-N |
| XLogP | 5.11 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|