C23H15F4NO4 — CID 146889360
6-[(3S)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pyridin-2-ylpropanoyl]-3H-1-benzofuran-2-one (PubChem CID 146889360) has the molecular formula C23H15F4NO4 and a molecular weight of 445.37 g/mol. Its IUPAC name is 6-[(3S)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pyridin-2-ylpropanoyl]-3H-1-benzofuran-2-one.
| Compound Name | 6-[(3S)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pyridin-2-ylpropanoyl]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 146889360 |
| Molecular Formula | C23H15F4NO4 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 6-[(3S)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pyridin-2-ylpropanoyl]-3H-1-benzofuran-2-one |
| SMILES | O=C1Cc2ccc(C(=O)C[C@@H](c3ccc(OC(F)(F)F)c(F)c3)c3ccccn3)cc2O1 |
| InChI | InChI=1S/C23H15F4NO4/c24-17-9-13(6-7-20(17)32-23(25,26)27)16(18-3-1-2-8-28-18)12-19(29)14-4-5-15-11-22(30)31-21(15)10-14/h1-10,16H,11-12H2/t16-/m0/s1 |
| InChIKey | SYUOPZWPTRXCLV-INIZCTEOSA-N |
| XLogP | 4.99 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|