C25H18F5N3O7 — CID 148868777
methyl 2-[5-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propanoyl]-N-methyl-2-nitroanilino]-2-oxoacetate (PubChem CID 148868777) has the molecular formula C25H18F5N3O7 and a molecular weight of 567.42 g/mol. Its IUPAC name is methyl 2-[5-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propanoyl]-N-methyl-2-nitroanilino]-2-oxoacetate.
| Compound Name | methyl 2-[5-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propanoyl]-N-methyl-2-nitroanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 148868777 |
| Molecular Formula | C25H18F5N3O7 |
| Molecular Weight | 567.42 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | methyl 2-[5-[(3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]propanoyl]-N-methyl-2-nitroanilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(C)c1cc(C(=O)C[C@@H](c2ccc(OC(F)(F)F)c(F)c2)c2ncccc2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H18F5N3O7/c1-32(23(35)24(36)39-2)19-11-14(5-7-18(19)33(37)38)20(34)12-15(22-16(26)4-3-9-31-22)13-6-8-21(17(27)10-13)40-25(28,29)30/h3-11,15H,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | PASZVXLKUFADDP-HNNXBMFYSA-N |
| XLogP | 4.71 |
| TPSA | 128.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|