C18H19Cl2N7O2 — CID 149381861
6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide (PubChem CID 149381861) has the molecular formula C18H19Cl2N7O2 and a molecular weight of 436.30 g/mol. Its IUPAC name is 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide.
| Compound Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 149381861 |
| Molecular Formula | C18H19Cl2N7O2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 6-(4-amino-4-methylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide |
| SMILES | CC1(N)CCN(c2nc3n[nH]c(-c4cccc(Cl)c4Cl)c3nc2C(=O)NO)CC1 |
| InChI | InChI=1S/C18H19Cl2N7O2/c1-18(21)5-7-27(8-6-18)16-14(17(28)26-29)22-13-12(24-25-15(13)23-16)9-3-2-4-10(19)11(9)20/h2-4,29H,5-8,21H2,1H3,(H,26,28)(H,23,24,25) |
| InChIKey | YLUPKODEUAOTIV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|