C19H20Cl2N6O2 — CID 158120526
3-(2,3-dichlorophenyl)-6-(4,4-dimethylpiperidin-1-yl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide (PubChem CID 158120526) has the molecular formula C19H20Cl2N6O2 and a molecular weight of 435.32 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-6-(4,4-dimethylpiperidin-1-yl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide.
| Compound Name | 3-(2,3-dichlorophenyl)-6-(4,4-dimethylpiperidin-1-yl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 158120526 |
| Molecular Formula | C19H20Cl2N6O2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-6-(4,4-dimethylpiperidin-1-yl)-N-hydroxy-2H-pyrazolo[3,4-b]pyrazine-5-carboxamide |
| SMILES | CC1(C)CCN(c2nc3n[nH]c(-c4cccc(Cl)c4Cl)c3nc2C(=O)NO)CC1 |
| InChI | InChI=1S/C19H20Cl2N6O2/c1-19(2)6-8-27(9-7-19)17-15(18(28)26-29)22-14-13(24-25-16(14)23-17)10-4-3-5-11(20)12(10)21/h3-5,29H,6-9H2,1-2H3,(H,26,28)(H,23,24,25) |
| InChIKey | APCMCRXGTKTOAO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|