C33H38N4O6 — CID 149384382
3-[2-methyl-4-[2-[1-(2-methylpropyl)-4-[2-[4-nitro-1-(3-phenylpropyl)pyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoethyl]pyrrol-1-yl]propanoic acid (PubChem CID 149384382) has the molecular formula C33H38N4O6 and a molecular weight of 586.69 g/mol. Its IUPAC name is 3-[2-methyl-4-[2-[1-(2-methylpropyl)-4-[2-[4-nitro-1-(3-phenylpropyl)pyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoethyl]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[2-methyl-4-[2-[1-(2-methylpropyl)-4-[2-[4-nitro-1-(3-phenylpropyl)pyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoethyl]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 149384382 |
| Molecular Formula | C33H38N4O6 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 3-[2-methyl-4-[2-[1-(2-methylpropyl)-4-[2-[4-nitro-1-(3-phenylpropyl)pyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoethyl]pyrrol-1-yl]propanoic acid |
| SMILES | Cc1cc(CC(=O)c2cc(CC(=O)c3cc([N+](=O)[O-])cn3CCCc3ccccc3)cn2CC(C)C)cn1CCC(=O)O |
| InChI | InChI=1S/C33H38N4O6/c1-23(2)19-36-21-27(15-29(36)31(38)16-26-14-24(3)34(20-26)13-11-33(40)41)17-32(39)30-18-28(37(42)43)22-35(30)12-7-10-25-8-5-4-6-9-25/h4-6,8-9,14-15,18,20-23H,7,10-13,16-17,19H2,1-3H3,(H,40,41) |
| InChIKey | YMHBLUGADNXOBK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|