C17H17F3S2 — CID 14938881
(1,1,1-trifluoro-2-phenylsulfanylpentan-2-yl)sulfanylbenzene (PubChem CID 14938881) has the molecular formula C17H17F3S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-phenylsulfanylpentan-2-yl)sulfanylbenzene.
| Compound Name | (1,1,1-trifluoro-2-phenylsulfanylpentan-2-yl)sulfanylbenzene |
|---|---|
| PubChem CID | 14938881 |
| Molecular Formula | C17H17F3S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (1,1,1-trifluoro-2-phenylsulfanylpentan-2-yl)sulfanylbenzene |
| SMILES | CCCC(Sc1ccccc1)(Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H17F3S2/c1-2-13-16(17(18,19)20,21-14-9-5-3-6-10-14)22-15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChIKey | KBEAJXDBXDUIFU-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|