About methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate
methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate (PubChem CID 149401055) has the molecular formula C18H16N4O3
and a molecular weight of 336.35 g/mol. Its IUPAC name is methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate |
| PubChem CID | 149401055 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate |
| SMILES | COC(=O)CCc1nc2ccccc2n1-c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H16N4O3/c1-25-17(23)9-8-16-19-13-4-2-3-5-15(13)22(16)11-6-7-12-14(10-11)21-18(24)20-12/h2-7,10H,8-9H2,1H3,(H2,20,21,24) |
| InChIKey | YPKCBFIYGPSVTH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate?
The IUPAC name of methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate (CID 149401055) is methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate.
What is the SMILES notation for methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate?
The canonical SMILES for methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate is COC(=O)CCc1nc2ccccc2n1-c1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate?
The InChIKey is YPKCBFIYGPSVTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O3/c1-25-17(23)9-8-16-19-13-4-2-3-5-15(13)22(16)11-6-7-12-14(10-11)21-18(24)20-12/h2-7,10H,8-9H2,1H3,(H2,20,21,24).
What are the key properties of methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate?
methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate has a molecular weight of 336.35 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzimidazol-2-yl]propanoate is sourced from PubChem (CID 149401055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).