C16H14FN3OS — CID 1494138
5-[[1-(4-fluorophenyl)pyrrol-2-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 1494138) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-[[1-(4-fluorophenyl)pyrrol-2-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[1-(4-fluorophenyl)pyrrol-2-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1494138 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-[[1-(4-fluorophenyl)pyrrol-2-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/SC(=Cc2cccn2-c2ccc(F)cc2)C(=O)N1C |
| InChI | InChI=1S/C16H14FN3OS/c1-18-16-19(2)15(21)14(22-16)10-13-4-3-9-20(13)12-7-5-11(17)6-8-12/h3-10H,1-2H3/b14-10?,18-16+ |
| InChIKey | IKMWBCQVYJRQSM-LYOGEXQLSA-N |
| XLogP | 3.15 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|